C24H21N5O2S — CID 6866870
N-[(Z)-[(Z)-3-(furan-2-yl)prop-2-enylidene]amino]-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide (PubChem CID 6866870) has the molecular formula C24H21N5O2S and a molecular weight of 443.53 g/mol. Its IUPAC name is N-[(Z)-[(Z)-3-(furan-2-yl)prop-2-enylidene]amino]-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide.
| Compound Name | N-[(Z)-[(Z)-3-(furan-2-yl)prop-2-enylidene]amino]-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 6866870 |
| Molecular Formula | C24H21N5O2S |
| Molecular Weight | 443.53 g/mol |
| Exact Mass | 443.14 |
| IUPAC Name | N-[(Z)-[(Z)-3-(furan-2-yl)prop-2-enylidene]amino]-2-[[4-(4-methylphenyl)-5-phenyl-1,2,4-triazol-3-yl]sulfanyl]acetamide |
| SMILES | Cc1ccc(-n2c(SCC(=O)N/N=C\C=C/c3ccco3)nnc2-c2ccccc2)cc1 |
| InChI | InChI=1S/C24H21N5O2S/c1-18-11-13-20(14-12-18)29-23(19-7-3-2-4-8-19)27-28-24(29)32-17-22(30)26-25-15-5-9-21-10-6-16-31-21/h2-16H,17H2,1H3,(H,26,30)/b9-5-,25-15- |
| InChIKey | SRUPAXPXBQFDKB-CMKNTCKNSA-N |
| XLogP | 4.74 |
| TPSA | 85.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.53 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|