C17H13N3O3 — CID 134122368
2-(4-methyl-5-phenyl-1,2,4-triazole-3-carbonyl)benzoic acid (PubChem CID 134122368) has the molecular formula C17H13N3O3 and a molecular weight of 307.31 g/mol. Its IUPAC name is 2-(4-methyl-5-phenyl-1,2,4-triazole-3-carbonyl)benzoic acid.
| Compound Name | 2-(4-methyl-5-phenyl-1,2,4-triazole-3-carbonyl)benzoic acid |
|---|---|
| PubChem CID | 134122368 |
| Molecular Formula | C17H13N3O3 |
| Molecular Weight | 307.31 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | 2-(4-methyl-5-phenyl-1,2,4-triazole-3-carbonyl)benzoic acid |
| SMILES | Cn1c(C(=O)c2ccccc2C(=O)O)nnc1-c1ccccc1 |
| InChI | InChI=1S/C17H13N3O3/c1-20-15(11-7-3-2-4-8-11)18-19-16(20)14(21)12-9-5-6-10-13(12)17(22)23/h2-10H,1H3,(H,22,23) |
| InChIKey | KAFNJBLQVNFOEI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |