C29H21N3O4 — CID 154425168
phenyl 4-[4-methyl-5-(4-phenoxycarbonylphenyl)-1,2,4-triazol-3-yl]benzoate (PubChem CID 154425168) has the molecular formula C29H21N3O4 and a molecular weight of 475.50 g/mol. Its IUPAC name is phenyl 4-[4-methyl-5-(4-phenoxycarbonylphenyl)-1,2,4-triazol-3-yl]benzoate.
| Compound Name | phenyl 4-[4-methyl-5-(4-phenoxycarbonylphenyl)-1,2,4-triazol-3-yl]benzoate |
|---|---|
| PubChem CID | 154425168 |
| Molecular Formula | C29H21N3O4 |
| Molecular Weight | 475.50 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | phenyl 4-[4-methyl-5-(4-phenoxycarbonylphenyl)-1,2,4-triazol-3-yl]benzoate |
| SMILES | Cn1c(-c2ccc(C(=O)Oc3ccccc3)cc2)nnc1-c1ccc(C(=O)Oc2ccccc2)cc1 |
| InChI | InChI=1S/C29H21N3O4/c1-32-26(20-12-16-22(17-13-20)28(33)35-24-8-4-2-5-9-24)30-31-27(32)21-14-18-23(19-15-21)29(34)36-25-10-6-3-7-11-25/h2-19H,1H3 |
| InChIKey | RUXUZNZKBFFTLI-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 83.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.50 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|