C19H13N5 — CID 95041767
4-[(E)-2-cyano-2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)ethenyl]benzonitrile (PubChem CID 95041767) has the molecular formula C19H13N5 and a molecular weight of 311.35 g/mol. Its IUPAC name is 4-[(E)-2-cyano-2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)ethenyl]benzonitrile.
| Compound Name | 4-[(E)-2-cyano-2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)ethenyl]benzonitrile |
|---|---|
| PubChem CID | 95041767 |
| Molecular Formula | C19H13N5 |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.12 |
| IUPAC Name | 4-[(E)-2-cyano-2-(4-methyl-5-phenyl-1,2,4-triazol-3-yl)ethenyl]benzonitrile |
| SMILES | Cn1c(/C(C#N)=C/c2ccc(C#N)cc2)nnc1-c1ccccc1 |
| InChI | InChI=1S/C19H13N5/c1-24-18(16-5-3-2-4-6-16)22-23-19(24)17(13-21)11-14-7-9-15(12-20)10-8-14/h2-11H,1H3/b17-11+ |
| InChIKey | BIWZELFMLAJURJ-GZTJUZNOSA-N |
| XLogP | 3.42 |
| TPSA | 78.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|