C22H20N4 — CID 6213822
(E)-3-(4-phenylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 6213822) has the molecular formula C22H20N4 and a molecular weight of 340.43 g/mol. Its IUPAC name is (E)-3-(4-phenylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(4-phenylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6213822 |
| Molecular Formula | C22H20N4 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | (E)-3-(4-phenylphenyl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(-c2ccccc2)cc1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C22H20N4/c23-16-20(22-25-24-21-9-5-2-6-14-26(21)22)15-17-10-12-19(13-11-17)18-7-3-1-4-8-18/h1,3-4,7-8,10-13,15H,2,5-6,9,14H2/b20-15+ |
| InChIKey | OLSUOTXKWVECBL-HMMYKYKNSA-N |
| XLogP | 4.74 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|