C15H16N4S — CID 6213821
(E)-3-(3-methylthiophen-2-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 6213821) has the molecular formula C15H16N4S and a molecular weight of 284.39 g/mol. Its IUPAC name is (E)-3-(3-methylthiophen-2-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-(3-methylthiophen-2-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6213821 |
| Molecular Formula | C15H16N4S |
| Molecular Weight | 284.39 g/mol |
| Exact Mass | 284.11 |
| IUPAC Name | (E)-3-(3-methylthiophen-2-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | Cc1ccsc1/C=C(\C#N)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C15H16N4S/c1-11-6-8-20-13(11)9-12(10-16)15-18-17-14-5-3-2-4-7-19(14)15/h6,8-9H,2-5,7H2,1H3/b12-9+ |
| InChIKey | PJFPOUQOHKQYGA-FMIVXFBMSA-N |
| XLogP | 3.44 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.39 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|