C24H26N6S — CID 75363202
(Z)-3-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 75363202) has the molecular formula C24H26N6S and a molecular weight of 430.58 g/mol. Its IUPAC name is (Z)-3-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (Z)-3-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 75363202 |
| Molecular Formula | C24H26N6S |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.19 |
| IUPAC Name | (Z)-3-(4-phenyl-2-piperidin-1-yl-1,3-thiazol-5-yl)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1sc(N2CCCCC2)nc1-c1ccccc1)c1nnc2n1CCCCC2 |
| InChI | InChI=1S/C24H26N6S/c25-17-19(23-28-27-21-12-6-2-9-15-30(21)23)16-20-22(18-10-4-1-5-11-18)26-24(31-20)29-13-7-3-8-14-29/h1,4-5,10-11,16H,2-3,6-9,12-15H2/b19-16- |
| InChIKey | FONVFQZQBCQAQY-MNDPQUGUSA-N |
| XLogP | 5.18 |
| TPSA | 70.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|