C19H22N4 — CID 8863058
(E)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-3-(2,4,6-trimethylphenyl)prop-2-enenitrile (PubChem CID 8863058) has the molecular formula C19H22N4 and a molecular weight of 306.41 g/mol. Its IUPAC name is (E)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-3-(2,4,6-trimethylphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-3-(2,4,6-trimethylphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 8863058 |
| Molecular Formula | C19H22N4 |
| Molecular Weight | 306.41 g/mol |
| Exact Mass | 306.18 |
| IUPAC Name | (E)-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)-3-(2,4,6-trimethylphenyl)prop-2-enenitrile |
| SMILES | Cc1cc(C)c(/C=C(\C#N)c2nnc3n2CCCCC3)c(C)c1 |
| InChI | InChI=1S/C19H22N4/c1-13-9-14(2)17(15(3)10-13)11-16(12-20)19-22-21-18-7-5-4-6-8-23(18)19/h9-11H,4-8H2,1-3H3/b16-11+ |
| InChIKey | FBRDXEQVKXELAK-LFIBNONCSA-N |
| XLogP | 3.99 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|