C24H24N4O — CID 27115487
(E)-3-[4-[(4-methylphenyl)methoxy]phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile (PubChem CID 27115487) has the molecular formula C24H24N4O and a molecular weight of 384.48 g/mol. Its IUPAC name is (E)-3-[4-[(4-methylphenyl)methoxy]phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile.
| Compound Name | (E)-3-[4-[(4-methylphenyl)methoxy]phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 27115487 |
| Molecular Formula | C24H24N4O |
| Molecular Weight | 384.48 g/mol |
| Exact Mass | 384.20 |
| IUPAC Name | (E)-3-[4-[(4-methylphenyl)methoxy]phenyl]-2-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(COc2ccc(/C=C(\C#N)c3nnc4n3CCCCC4)cc2)cc1 |
| InChI | InChI=1S/C24H24N4O/c1-18-6-8-20(9-7-18)17-29-22-12-10-19(11-13-22)15-21(16-25)24-27-26-23-5-3-2-4-14-28(23)24/h6-13,15H,2-5,14,17H2,1H3/b21-15+ |
| InChIKey | DSKLCWOUVLLEIT-RCCKNPSSSA-N |
| XLogP | 4.96 |
| TPSA | 63.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|