C17H14N2O2 — CID 3527277
2-cyano-5-(furan-2-yl)-N-(4-methylphenyl)penta-2,4-dienamide (PubChem CID 3527277) has the molecular formula C17H14N2O2 and a molecular weight of 278.31 g/mol. Its IUPAC name is 2-cyano-5-(furan-2-yl)-N-(4-methylphenyl)penta-2,4-dienamide.
| Compound Name | 2-cyano-5-(furan-2-yl)-N-(4-methylphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 3527277 |
| Molecular Formula | C17H14N2O2 |
| Molecular Weight | 278.31 g/mol |
| Exact Mass | 278.11 |
| IUPAC Name | 2-cyano-5-(furan-2-yl)-N-(4-methylphenyl)penta-2,4-dienamide |
| SMILES | Cc1ccc(NC(=O)C(C#N)=CC=Cc2ccco2)cc1 |
| InChI | InChI=1S/C17H14N2O2/c1-13-7-9-15(10-8-13)19-17(20)14(12-18)4-2-5-16-6-3-11-21-16/h2-11H,1H3,(H,19,20) |
| InChIKey | OVSQTUCFZONJKR-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 66.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.31 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|