C22H19N5O — CID 9353205
(2E,4E)-5-(1-benzyltriazol-4-yl)-2-cyano-N-(4-methylphenyl)penta-2,4-dienamide (PubChem CID 9353205) has the molecular formula C22H19N5O and a molecular weight of 369.43 g/mol. Its IUPAC name is (2E,4E)-5-(1-benzyltriazol-4-yl)-2-cyano-N-(4-methylphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-5-(1-benzyltriazol-4-yl)-2-cyano-N-(4-methylphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 9353205 |
| Molecular Formula | C22H19N5O |
| Molecular Weight | 369.43 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (2E,4E)-5-(1-benzyltriazol-4-yl)-2-cyano-N-(4-methylphenyl)penta-2,4-dienamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C/C=C/c2cn(Cc3ccccc3)nn2)cc1 |
| InChI | InChI=1S/C22H19N5O/c1-17-10-12-20(13-11-17)24-22(28)19(14-23)8-5-9-21-16-27(26-25-21)15-18-6-3-2-4-7-18/h2-13,16H,15H2,1H3,(H,24,28)/b9-5+,19-8+ |
| InChIKey | BLUFDRWPRGFUOE-SVAOYLBTSA-N |
| XLogP | 3.74 |
| TPSA | 83.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.43 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|