C20H13BrN2S — CID 23762350
5-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-phenylpenta-2,4-dienenitrile (PubChem CID 23762350) has the molecular formula C20H13BrN2S and a molecular weight of 393.31 g/mol. Its IUPAC name is 5-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-phenylpenta-2,4-dienenitrile.
| Compound Name | 5-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 23762350 |
| Molecular Formula | C20H13BrN2S |
| Molecular Weight | 393.31 g/mol |
| Exact Mass | 392.00 |
| IUPAC Name | 5-[4-(4-bromophenyl)-1,3-thiazol-2-yl]-2-phenylpenta-2,4-dienenitrile |
| SMILES | N#CC(=CC=Cc1nc(-c2ccc(Br)cc2)cs1)c1ccccc1 |
| InChI | InChI=1S/C20H13BrN2S/c21-18-11-9-16(10-12-18)19-14-24-20(23-19)8-4-7-17(13-22)15-5-2-1-3-6-15/h1-12,14H |
| InChIKey | CSVVULFJRHYTIX-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.31 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|