C16H12N2OSe — CID 136703535
(NZ)-N-[phenyl-(4-phenyl-1,3-selenazol-2-yl)methylidene]hydroxylamine (PubChem CID 136703535) has the molecular formula C16H12N2OSe and a molecular weight of 327.25 g/mol. Its IUPAC name is (NZ)-N-[phenyl-(4-phenyl-1,3-selenazol-2-yl)methylidene]hydroxylamine.
| Compound Name | (NZ)-N-[phenyl-(4-phenyl-1,3-selenazol-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 136703535 |
| Molecular Formula | C16H12N2OSe |
| Molecular Weight | 327.25 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | (NZ)-N-[phenyl-(4-phenyl-1,3-selenazol-2-yl)methylidene]hydroxylamine |
| SMILES | O/N=C(/c1ccccc1)c1nc(-c2ccccc2)c[se]1 |
| InChI | InChI=1S/C16H12N2OSe/c19-18-15(13-9-5-2-6-10-13)16-17-14(11-20-16)12-7-3-1-4-8-12/h1-11,19H/b18-15- |
| InChIKey | XPOHGJBOADHDPK-SDXDJHTJSA-N |
| XLogP | 3.03 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.25 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|