C15H10ClNSe — CID 15468155
2-(4-chlorophenyl)-4-phenyl-1,3-selenazole (PubChem CID 15468155) has the molecular formula C15H10ClNSe and a molecular weight of 318.67 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-4-phenyl-1,3-selenazole.
| Compound Name | 2-(4-chlorophenyl)-4-phenyl-1,3-selenazole |
|---|---|
| PubChem CID | 15468155 |
| Molecular Formula | C15H10ClNSe |
| Molecular Weight | 318.67 g/mol |
| Exact Mass | 318.97 |
| IUPAC Name | 2-(4-chlorophenyl)-4-phenyl-1,3-selenazole |
| SMILES | Clc1ccc(-c2nc(-c3ccccc3)c[se]2)cc1 |
| InChI | InChI=1S/C15H10ClNSe/c16-13-8-6-12(7-9-13)15-17-14(10-18-15)11-4-2-1-3-5-11/h1-10H |
| InChIKey | RYIVUXSUEMYKFL-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.67 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|