C11H12N2Se — CID 15437866
N,N-dimethyl-4-phenyl-1,3-selenazol-2-amine (PubChem CID 15437866) has the molecular formula C11H12N2Se and a molecular weight of 251.19 g/mol. Its IUPAC name is N,N-dimethyl-4-phenyl-1,3-selenazol-2-amine.
| Compound Name | N,N-dimethyl-4-phenyl-1,3-selenazol-2-amine |
|---|---|
| PubChem CID | 15437866 |
| Molecular Formula | C11H12N2Se |
| Molecular Weight | 251.19 g/mol |
| Exact Mass | 252.02 |
| IUPAC Name | N,N-dimethyl-4-phenyl-1,3-selenazol-2-amine |
| SMILES | CN(C)c1nc(-c2ccccc2)c[se]1 |
| InChI | InChI=1S/C11H12N2Se/c1-13(2)11-12-10(8-14-11)9-6-4-3-5-7-9/h3-8H,1-2H3 |
| InChIKey | FAWACSAMXFCPIU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.19 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|