C20H15N3O2S2 — CID 172917333
phenyl(1,3-thiazol-2-yl)methanone;(NE)-N-[phenyl(1,3-thiazol-2-yl)methylidene]hydroxylamine (PubChem CID 172917333) has the molecular formula C20H15N3O2S2 and a molecular weight of 393.49 g/mol. Its IUPAC name is phenyl(1,3-thiazol-2-yl)methanone;(NE)-N-[phenyl(1,3-thiazol-2-yl)methylidene]hydroxylamine.
| Compound Name | phenyl(1,3-thiazol-2-yl)methanone;(NE)-N-[phenyl(1,3-thiazol-2-yl)methylidene]hydroxylamine |
|---|---|
| PubChem CID | 172917333 |
| Molecular Formula | C20H15N3O2S2 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.06 |
| IUPAC Name | phenyl(1,3-thiazol-2-yl)methanone;(NE)-N-[phenyl(1,3-thiazol-2-yl)methylidene]hydroxylamine |
| SMILES | O/N=C(\c1ccccc1)c1nccs1.O=C(c1ccccc1)c1nccs1 |
| InChI | InChI=1S/C10H8N2OS.C10H7NOS/c13-12-9(10-11-6-7-14-10)8-4-2-1-3-5-8;12-9(10-11-6-7-13-10)8-4-2-1-3-5-8/h1-7,13H;1-7H/b12-9+; |
| InChIKey | KXMJSXSLHVWHFR-NBYYMMLRSA-N |
| XLogP | 4.74 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|