C17H14N2OS — CID 138454482
2-[4-(2-oxopropyl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile (PubChem CID 138454482) has the molecular formula C17H14N2OS and a molecular weight of 294.38 g/mol. Its IUPAC name is 2-[4-(2-oxopropyl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile.
| Compound Name | 2-[4-(2-oxopropyl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile |
|---|---|
| PubChem CID | 138454482 |
| Molecular Formula | C17H14N2OS |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.08 |
| IUPAC Name | 2-[4-(2-oxopropyl)-1,3-thiazol-2-yl]-5-phenylpenta-2,4-dienenitrile |
| SMILES | CC(=O)Cc1csc(C(C#N)=CC=Cc2ccccc2)n1 |
| InChI | InChI=1S/C17H14N2OS/c1-13(20)10-16-12-21-17(19-16)15(11-18)9-5-8-14-6-3-2-4-7-14/h2-9,12H,10H2,1H3 |
| InChIKey | RWAWJCYUJYWTPE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 53.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|