C17H19NO2Si — CID 124629224
[ethenyl(dimethyl)silyl]methyl (2E,4Z)-2-cyano-5-phenylpenta-2,4-dienoate (PubChem CID 124629224) has the molecular formula C17H19NO2Si and a molecular weight of 297.43 g/mol. Its IUPAC name is [ethenyl(dimethyl)silyl]methyl (2E,4Z)-2-cyano-5-phenylpenta-2,4-dienoate.
| Compound Name | [ethenyl(dimethyl)silyl]methyl (2E,4Z)-2-cyano-5-phenylpenta-2,4-dienoate |
|---|---|
| PubChem CID | 124629224 |
| Molecular Formula | C17H19NO2Si |
| Molecular Weight | 297.43 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | [ethenyl(dimethyl)silyl]methyl (2E,4Z)-2-cyano-5-phenylpenta-2,4-dienoate |
| SMILES | C=C[Si](C)(C)COC(=O)/C(C#N)=C/C=C\c1ccccc1 |
| InChI | InChI=1S/C17H19NO2Si/c1-4-21(2,3)14-20-17(19)16(13-18)12-8-11-15-9-6-5-7-10-15/h4-12H,1,14H2,2-3H3/b11-8-,16-12+ |
| InChIKey | RNQRADIVJDJMQR-HLHGXTSASA-N |
| XLogP | 3.67 |
| TPSA | 50.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|