C35H36N2 — CID 142304751
4-[4-[9-[4-[(1E,3E)-4-cyanohexa-1,3,5-trienyl]phenyl]nonyl]phenyl]benzonitrile (PubChem CID 142304751) has the molecular formula C35H36N2 and a molecular weight of 484.69 g/mol. Its IUPAC name is 4-[4-[9-[4-[(1E,3E)-4-cyanohexa-1,3,5-trienyl]phenyl]nonyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[9-[4-[(1E,3E)-4-cyanohexa-1,3,5-trienyl]phenyl]nonyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 142304751 |
| Molecular Formula | C35H36N2 |
| Molecular Weight | 484.69 g/mol |
| Exact Mass | 484.29 |
| IUPAC Name | 4-[4-[9-[4-[(1E,3E)-4-cyanohexa-1,3,5-trienyl]phenyl]nonyl]phenyl]benzonitrile |
| SMILES | C=C/C(C#N)=C\C=C\c1ccc(CCCCCCCCCc2ccc(-c3ccc(C#N)cc3)cc2)cc1 |
| InChI | InChI=1S/C35H36N2/c1-2-29(27-36)13-10-14-32-17-15-30(16-18-32)11-8-6-4-3-5-7-9-12-31-19-23-34(24-20-31)35-25-21-33(28-37)22-26-35/h2,10,13-26H,1,3-9,11-12H2/b14-10+,29-13+ |
| InChIKey | DURNUNYPSWGQQH-LDTNBRTGSA-N |
| XLogP | 9.39 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.69 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|