C17H13NS — CID 162490527
4-[4-[(1E,3E)-4-sulfanylbuta-1,3-dienyl]phenyl]benzonitrile (PubChem CID 162490527) has the molecular formula C17H13NS and a molecular weight of 263.37 g/mol. Its IUPAC name is 4-[4-[(1E,3E)-4-sulfanylbuta-1,3-dienyl]phenyl]benzonitrile.
| Compound Name | 4-[4-[(1E,3E)-4-sulfanylbuta-1,3-dienyl]phenyl]benzonitrile |
|---|---|
| PubChem CID | 162490527 |
| Molecular Formula | C17H13NS |
| Molecular Weight | 263.37 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | 4-[4-[(1E,3E)-4-sulfanylbuta-1,3-dienyl]phenyl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc(/C=C/C=C/S)cc2)cc1 |
| InChI | InChI=1S/C17H13NS/c18-13-15-6-10-17(11-7-15)16-8-4-14(5-9-16)3-1-2-12-19/h1-12,19H/b3-1+,12-2+ |
| InChIKey | RKWXIZYYNIEGHO-DZPBGTKHSA-N |
| XLogP | 4.68 |
| TPSA | 23.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.37 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|