C18H11ClN2 — CID 102346043
4-[(1E,3Z)-4-chloro-4-(4-cyanophenyl)buta-1,3-dienyl]benzonitrile (PubChem CID 102346043) has the molecular formula C18H11ClN2 and a molecular weight of 290.75 g/mol. Its IUPAC name is 4-[(1E,3Z)-4-chloro-4-(4-cyanophenyl)buta-1,3-dienyl]benzonitrile.
| Compound Name | 4-[(1E,3Z)-4-chloro-4-(4-cyanophenyl)buta-1,3-dienyl]benzonitrile |
|---|---|
| PubChem CID | 102346043 |
| Molecular Formula | C18H11ClN2 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 4-[(1E,3Z)-4-chloro-4-(4-cyanophenyl)buta-1,3-dienyl]benzonitrile |
| SMILES | N#Cc1ccc(/C=C/C=C(\Cl)c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C18H11ClN2/c19-18(17-10-8-16(13-21)9-11-17)3-1-2-14-4-6-15(12-20)7-5-14/h1-11H/b2-1+,18-3- |
| InChIKey | ALBHBHPPTWGBPL-WMXJQNAUSA-N |
| XLogP | 4.72 |
| TPSA | 47.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|