About 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile
4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile (PubChem CID 160955295) has the molecular formula C22H24N2O
and a molecular weight of 332.45 g/mol. Its IUPAC name is 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile.
Molecular Properties
| Compound Name | 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile |
| PubChem CID | 160955295 |
| Molecular Formula | C22H24N2O |
| Molecular Weight | 332.45 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile |
| SMILES | C=CCCc1ccc(C#N)cc1.N#Cc1ccc(CCCCO)cc1 |
| InChI | InChI=1S/C11H13NO.C11H11N/c12-9-11-6-4-10(5-7-11)3-1-2-8-13;1-2-3-4-10-5-7-11(9-12)8-6-10/h4-7,13H,1-3,8H2;2,5-8H,1,3-4H2 |
| InChIKey | SWHOSKHDXHPCST-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 67.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.45 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile?
The IUPAC name of 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile (CID 160955295) is 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile.
What is the SMILES notation for 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile?
The canonical SMILES for 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile is C=CCCc1ccc(C#N)cc1.N#Cc1ccc(CCCCO)cc1.
What is the InChIKey of 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile?
The InChIKey is SWHOSKHDXHPCST-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NO.C11H11N/c12-9-11-6-4-10(5-7-11)3-1-2-8-13;1-2-3-4-10-5-7-11(9-12)8-6-10/h4-7,13H,1-3,8H2;2,5-8H,1,3-4H2.
What are the key properties of 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile?
4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile has a molecular weight of 332.45 g/mol, XLogP of 4.55, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-but-3-enylbenzonitrile;4-(4-hydroxybutyl)benzonitrile is sourced from PubChem (CID 160955295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).