About 4-hex-5-enylbenzonitrile
4-hex-5-enylbenzonitrile (PubChem CID 582246) has the molecular formula C13H15N
and a molecular weight of 185.27 g/mol. Its IUPAC name is 4-hex-5-enylbenzonitrile.
Molecular Properties
| Compound Name | 4-hex-5-enylbenzonitrile |
| PubChem CID | 582246 |
| Molecular Formula | C13H15N |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.12 |
| IUPAC Name | 4-hex-5-enylbenzonitrile |
| SMILES | C=CCCCCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C13H15N/c1-2-3-4-5-6-12-7-9-13(11-14)10-8-12/h2,7-10H,1,3-6H2 |
| InChIKey | FMYDJPHTBGDCJH-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-hex-5-enylbenzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-hex-5-enylbenzonitrile?
The IUPAC name of 4-hex-5-enylbenzonitrile (CID 582246) is 4-hex-5-enylbenzonitrile.
What is the SMILES notation for 4-hex-5-enylbenzonitrile?
The canonical SMILES for 4-hex-5-enylbenzonitrile is C=CCCCCc1ccc(C#N)cc1.
What is the InChIKey of 4-hex-5-enylbenzonitrile?
The InChIKey is FMYDJPHTBGDCJH-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H15N/c1-2-3-4-5-6-12-7-9-13(11-14)10-8-12/h2,7-10H,1,3-6H2.
What are the key properties of 4-hex-5-enylbenzonitrile?
4-hex-5-enylbenzonitrile has a molecular weight of 185.27 g/mol, XLogP of 3.46, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-hex-5-enylbenzonitrile is sourced from PubChem (CID 582246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).