C26H37NSi — CID 139630757
4-[4-(7-triethylsilylheptyl)phenyl]benzonitrile (PubChem CID 139630757) has the molecular formula C26H37NSi and a molecular weight of 391.68 g/mol. Its IUPAC name is 4-[4-(7-triethylsilylheptyl)phenyl]benzonitrile.
| Compound Name | 4-[4-(7-triethylsilylheptyl)phenyl]benzonitrile |
|---|---|
| PubChem CID | 139630757 |
| Molecular Formula | C26H37NSi |
| Molecular Weight | 391.68 g/mol |
| Exact Mass | 391.27 |
| IUPAC Name | 4-[4-(7-triethylsilylheptyl)phenyl]benzonitrile |
| SMILES | CC[Si](CC)(CC)CCCCCCCc1ccc(-c2ccc(C#N)cc2)cc1 |
| InChI | InChI=1S/C26H37NSi/c1-4-28(5-2,6-3)21-11-9-7-8-10-12-23-13-17-25(18-14-23)26-19-15-24(22-27)16-20-26/h13-20H,4-12,21H2,1-3H3 |
| InChIKey | VSTJVUMIRWVUDT-UHFFFAOYSA-N |
| XLogP | 8.23 |
| TPSA | 23.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.68 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|