C24H26N2O2 — CID 2232702
N-[(2Z,4Z)-1-(cyclohexylamino)-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide (PubChem CID 2232702) has the molecular formula C24H26N2O2 and a molecular weight of 374.48 g/mol. Its IUPAC name is N-[(2Z,4Z)-1-(cyclohexylamino)-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide.
| Compound Name | N-[(2Z,4Z)-1-(cyclohexylamino)-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
|---|---|
| PubChem CID | 2232702 |
| Molecular Formula | C24H26N2O2 |
| Molecular Weight | 374.48 g/mol |
| Exact Mass | 374.20 |
| IUPAC Name | N-[(2Z,4Z)-1-(cyclohexylamino)-1-oxo-5-phenylpenta-2,4-dien-2-yl]benzamide |
| SMILES | O=C(NC1CCCCC1)/C(=C/C=C\c1ccccc1)NC(=O)c1ccccc1 |
| InChI | InChI=1S/C24H26N2O2/c27-23(20-14-6-2-7-15-20)26-22(18-10-13-19-11-4-1-5-12-19)24(28)25-21-16-8-3-9-17-21/h1-2,4-7,10-15,18,21H,3,8-9,16-17H2,(H,25,28)(H,26,27)/b13-10-,22-18- |
| InChIKey | COSDAFIAVGHDCX-VFQLDLCJSA-N |
| XLogP | 4.46 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.48 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|