About N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide
N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide (PubChem CID 10693566) has the molecular formula C21H17N3O5S
and a molecular weight of 423.45 g/mol. Its IUPAC name is N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide.
Molecular Properties
| Compound Name | N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide |
| PubChem CID | 10693566 |
| Molecular Formula | C21H17N3O5S |
| Molecular Weight | 423.45 g/mol |
| Exact Mass | 423.09 |
| IUPAC Name | N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide |
| SMILES | O=C(NCc1ccccc1)c1c([N+](=O)[O-])cc(SCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C21H17N3O5S/c25-21(22-13-15-7-3-1-4-8-15)20-18(23(26)27)11-17(12-19(20)24(28)29)30-14-16-9-5-2-6-10-16/h1-12H,13-14H2,(H,22,25) |
| InChIKey | FVSSUPIICOFQAF-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 423.45 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide?
The IUPAC name of N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide (CID 10693566) is N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide.
What is the SMILES notation for N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide?
The canonical SMILES for N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide is O=C(NCc1ccccc1)c1c([N+](=O)[O-])cc(SCc2ccccc2)cc1[N+](=O)[O-].
What is the InChIKey of N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide?
The InChIKey is FVSSUPIICOFQAF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17N3O5S/c25-21(22-13-15-7-3-1-4-8-15)20-18(23(26)27)11-17(12-19(20)24(28)29)30-14-16-9-5-2-6-10-16/h1-12H,13-14H2,(H,22,25).
What are the key properties of N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide?
N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide has a molecular weight of 423.45 g/mol, XLogP of 4.73, 8 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-4-benzylsulfanyl-2,6-dinitrobenzamide is sourced from PubChem (CID 10693566), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).