C20H15N3O5S — CID 10835328
4-benzylsulfanyl-2,6-dinitro-N-phenylbenzamide (PubChem CID 10835328) has the molecular formula C20H15N3O5S and a molecular weight of 409.42 g/mol. Its IUPAC name is 4-benzylsulfanyl-2,6-dinitro-N-phenylbenzamide.
| Compound Name | 4-benzylsulfanyl-2,6-dinitro-N-phenylbenzamide |
|---|---|
| PubChem CID | 10835328 |
| Molecular Formula | C20H15N3O5S |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.07 |
| IUPAC Name | 4-benzylsulfanyl-2,6-dinitro-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1c([N+](=O)[O-])cc(SCc2ccccc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H15N3O5S/c24-20(21-15-9-5-2-6-10-15)19-17(22(25)26)11-16(12-18(19)23(27)28)29-13-14-7-3-1-4-8-14/h1-12H,13H2,(H,21,24) |
| InChIKey | ASWAKSNQEJLMCW-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 115.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|