C21H18N2O3S — CID 1255671
4-[(4-methylphenyl)sulfanylmethyl]-N-(3-nitrophenyl)benzamide (PubChem CID 1255671) has the molecular formula C21H18N2O3S and a molecular weight of 378.45 g/mol. Its IUPAC name is 4-[(4-methylphenyl)sulfanylmethyl]-N-(3-nitrophenyl)benzamide.
| Compound Name | 4-[(4-methylphenyl)sulfanylmethyl]-N-(3-nitrophenyl)benzamide |
|---|---|
| PubChem CID | 1255671 |
| Molecular Formula | C21H18N2O3S |
| Molecular Weight | 378.45 g/mol |
| Exact Mass | 378.10 |
| IUPAC Name | 4-[(4-methylphenyl)sulfanylmethyl]-N-(3-nitrophenyl)benzamide |
| SMILES | Cc1ccc(SCc2ccc(C(=O)Nc3cccc([N+](=O)[O-])c3)cc2)cc1 |
| InChI | InChI=1S/C21H18N2O3S/c1-15-5-11-20(12-6-15)27-14-16-7-9-17(10-8-16)21(24)22-18-3-2-4-19(13-18)23(25)26/h2-13H,14H2,1H3,(H,22,24) |
| InChIKey | DYEYFTAQEYBLEF-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 72.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.45 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|