C10H9BrN2O5 — CID 130406359
1-(2-bromo-4,6-dinitrophenyl)butan-2-one (PubChem CID 130406359) has the molecular formula C10H9BrN2O5 and a molecular weight of 317.10 g/mol. Its IUPAC name is 1-(2-bromo-4,6-dinitrophenyl)butan-2-one.
| Compound Name | 1-(2-bromo-4,6-dinitrophenyl)butan-2-one |
|---|---|
| PubChem CID | 130406359 |
| Molecular Formula | C10H9BrN2O5 |
| Molecular Weight | 317.10 g/mol |
| Exact Mass | 315.97 |
| IUPAC Name | 1-(2-bromo-4,6-dinitrophenyl)butan-2-one |
| SMILES | CCC(=O)Cc1c(Br)cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C10H9BrN2O5/c1-2-7(14)5-8-9(11)3-6(12(15)16)4-10(8)13(17)18/h3-4H,2,5H2,1H3 |
| InChIKey | QZYPBAUQIYUQBE-UHFFFAOYSA-N |
| XLogP | 2.79 |
| TPSA | 103.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.10 |
| LogP ≤ 5 | 2.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|