About 3-bromo-2-ethylbenzoate
3-bromo-2-ethylbenzoate (PubChem CID 86307338) has the molecular formula C9H8BrO2-
and a molecular weight of 228.06 g/mol. Its IUPAC name is 3-bromo-2-ethylbenzoate.
Molecular Properties
| Compound Name | 3-bromo-2-ethylbenzoate |
| PubChem CID | 86307338 |
| Molecular Formula | C9H8BrO2- |
| Molecular Weight | 228.06 g/mol |
| Exact Mass | 226.97 |
| IUPAC Name | 3-bromo-2-ethylbenzoate |
| SMILES | CCc1c(Br)cccc1C(=O)[O-] |
| InChI | InChI=1S/C9H9BrO2/c1-2-6-7(9(11)12)4-3-5-8(6)10/h3-5H,2H2,1H3,(H,11,12)/p-1 |
| InChIKey | VXQLZSPAHPPVPE-UHFFFAOYSA-M |
| XLogP | 1.38 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.06 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-bromo-2-ethylbenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-2-ethylbenzoate?
The IUPAC name of 3-bromo-2-ethylbenzoate (CID 86307338) is 3-bromo-2-ethylbenzoate.
What is the SMILES notation for 3-bromo-2-ethylbenzoate?
The canonical SMILES for 3-bromo-2-ethylbenzoate is CCc1c(Br)cccc1C(=O)[O-].
What is the InChIKey of 3-bromo-2-ethylbenzoate?
The InChIKey is VXQLZSPAHPPVPE-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H9BrO2/c1-2-6-7(9(11)12)4-3-5-8(6)10/h3-5H,2H2,1H3,(H,11,12)/p-1.
What are the key properties of 3-bromo-2-ethylbenzoate?
3-bromo-2-ethylbenzoate has a molecular weight of 228.06 g/mol, XLogP of 1.38, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-2-ethylbenzoate is sourced from PubChem (CID 86307338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).