About 4-azaniumylbutylazanium;bis(2-bromobenzoate)
4-azaniumylbutylazanium;bis(2-bromobenzoate) (PubChem CID 139146269) has the molecular formula C18H22Br2N2O4
and a molecular weight of 490.19 g/mol. Its IUPAC name is 4-azaniumylbutylazanium;bis(2-bromobenzoate).
Molecular Properties
| Compound Name | 4-azaniumylbutylazanium;bis(2-bromobenzoate) |
| PubChem CID | 139146269 |
| Molecular Formula | C18H22Br2N2O4 |
| Molecular Weight | 490.19 g/mol |
| Exact Mass | 487.99 |
| IUPAC Name | 4-azaniumylbutylazanium;bis(2-bromobenzoate) |
| SMILES | O=C([O-])c1ccccc1Br.O=C([O-])c1ccccc1Br.[NH3+]CCCC[NH3+] |
| InChI | InChI=1S/2C7H5BrO2.C4H12N2/c2*8-6-4-2-1-3-5(6)7(9)10;5-3-1-2-4-6/h2*1-4H,(H,9,10);1-6H2 |
| InChIKey | JYLBHUZMJXAGRL-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 135.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 490.19 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-azaniumylbutylazanium;bis(2-bromobenzoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azaniumylbutylazanium;bis(2-bromobenzoate)?
The IUPAC name of 4-azaniumylbutylazanium;bis(2-bromobenzoate) (CID 139146269) is 4-azaniumylbutylazanium;bis(2-bromobenzoate).
What is the SMILES notation for 4-azaniumylbutylazanium;bis(2-bromobenzoate)?
The canonical SMILES for 4-azaniumylbutylazanium;bis(2-bromobenzoate) is O=C([O-])c1ccccc1Br.O=C([O-])c1ccccc1Br.[NH3+]CCCC[NH3+].
What is the InChIKey of 4-azaniumylbutylazanium;bis(2-bromobenzoate)?
The InChIKey is JYLBHUZMJXAGRL-UHFFFAOYSA-N. The full InChI is InChI=1S/2C7H5BrO2.C4H12N2/c2*8-6-4-2-1-3-5(6)7(9)10;5-3-1-2-4-6/h2*1-4H,(H,9,10);1-6H2.
What are the key properties of 4-azaniumylbutylazanium;bis(2-bromobenzoate)?
4-azaniumylbutylazanium;bis(2-bromobenzoate) has a molecular weight of 490.19 g/mol, XLogP of -0.12, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azaniumylbutylazanium;bis(2-bromobenzoate) is sourced from PubChem (CID 139146269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).