About 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene
1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene (PubChem CID 101207854) has the molecular formula C24H12N2O4
and a molecular weight of 392.37 g/mol. Its IUPAC name is 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene.
Molecular Properties
| Compound Name | 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene |
| PubChem CID | 101207854 |
| Molecular Formula | C24H12N2O4 |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.08 |
| IUPAC Name | 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene |
| SMILES | O=[N+]([O-])c1cccc2c(C#CC#Cc3cccc4c([N+](=O)[O-])cccc34)cccc12 |
| InChI | InChI=1S/C24H12N2O4/c27-25(28)23-15-5-11-19-17(9-3-13-21(19)23)7-1-2-8-18-10-4-14-22-20(18)12-6-16-24(22)26(29)30/h3-6,9-16H |
| InChIKey | WMAYMTZXKTYRHB-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene?
The IUPAC name of 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene (CID 101207854) is 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene.
What is the SMILES notation for 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene?
The canonical SMILES for 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene is O=[N+]([O-])c1cccc2c(C#CC#Cc3cccc4c([N+](=O)[O-])cccc34)cccc12.
What is the InChIKey of 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene?
The InChIKey is WMAYMTZXKTYRHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H12N2O4/c27-25(28)23-15-5-11-19-17(9-3-13-21(19)23)7-1-2-8-18-10-4-14-22-20(18)12-6-16-24(22)26(29)30/h3-6,9-16H.
What are the key properties of 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene?
1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene has a molecular weight of 392.37 g/mol, XLogP of 5.21, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-nitro-5-[4-(5-nitronaphthalen-1-yl)buta-1,3-diynyl]naphthalene is sourced from PubChem (CID 101207854), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).