C12H5N3O7S — CID 139879502
1,3,7-trinitrodibenzothiophene 5-oxide (PubChem CID 139879502) has the molecular formula C12H5N3O7S and a molecular weight of 335.25 g/mol. Its IUPAC name is 1,3,7-trinitrodibenzothiophene 5-oxide.
| Compound Name | 1,3,7-trinitrodibenzothiophene 5-oxide |
|---|---|
| PubChem CID | 139879502 |
| Molecular Formula | C12H5N3O7S |
| Molecular Weight | 335.25 g/mol |
| Exact Mass | 334.98 |
| IUPAC Name | 1,3,7-trinitrodibenzothiophene 5-oxide |
| SMILES | O=[N+]([O-])c1ccc2c(c1)S(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1-2 |
| InChI | InChI=1S/C12H5N3O7S/c16-13(17)6-1-2-8-10(4-6)23(22)11-5-7(14(18)19)3-9(12(8)11)15(20)21/h1-5H |
| InChIKey | QDAUPJONURGRIY-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 146.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.25 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|