About CID 11814542
CID 11814542 (PubChem CID 11814542) has the molecular formula C34H29FeN3O11+2
and a molecular weight of 711.46 g/mol.
Molecular Properties
| Compound Name | CID 11814542 |
| PubChem CID | 11814542 |
| Molecular Formula | C34H29FeN3O11+2 |
| Molecular Weight | 711.46 g/mol |
| Exact Mass | 711.11 |
| IUPAC Name | — |
| SMILES | COCCOCCOCCOC(=O)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])/C2=C\C#C[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2] |
| InChI | InChI=1S/C29H24N3O11.C5H5.Fe/c1-40-9-10-41-11-12-42-13-14-43-29(33)25-17-20(30(34)35)15-23-22(8-4-7-19-5-2-3-6-19)24-16-21(31(36)37)18-26(32(38)39)28(24)27(23)25;1-2-4-5-3-1;/h2-3,5-6,8,15-18H,9-14H2,1H3;1-5H;/q;;+2/b22-8-;; |
| InChIKey | VOTRSSCCSSUFNJ-VHWAHFDZSA-N |
| XLogP | 5.09 |
| TPSA | 183.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 49 |
| Complexity | — |
Lipinski Rule of Five
3 violations
| Rule | Value |
| MW ≤ 500 | 711.46 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze CID 11814542 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11814542?
The IUPAC name of CID 11814542 (CID 11814542) is not available.
What is the SMILES notation for CID 11814542?
The canonical SMILES for CID 11814542 is COCCOCCOCCOC(=O)c1cc([N+](=O)[O-])cc2c1-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])/C2=C\C#C[C]1[CH][CH][CH][CH]1.[CH]1[CH][CH][CH][CH]1.[Fe+2].
What is the InChIKey of CID 11814542?
The InChIKey is VOTRSSCCSSUFNJ-VHWAHFDZSA-N. The full InChI is InChI=1S/C29H24N3O11.C5H5.Fe/c1-40-9-10-41-11-12-42-13-14-43-29(33)25-17-20(30(34)35)15-23-22(8-4-7-19-5-2-3-6-19)24-16-21(31(36)37)18-26(32(38)39)28(24)27(23)25;1-2-4-5-3-1;/h2-3,5-6,8,15-18H,9-14H2,1H3;1-5H;/q;;+2/b22-8-;;.
What are the key properties of CID 11814542?
CID 11814542 has a molecular weight of 711.46 g/mol, XLogP of 5.09, 13 rotatable bonds, 0 hydrogen bond donors, and 11 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11814542 is sourced from PubChem (CID 11814542), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).