C10H9F2NO5 — CID 107123604
2-methoxyethyl 2,5-difluoro-3-nitrobenzoate (PubChem CID 107123604) has the molecular formula C10H9F2NO5 and a molecular weight of 261.18 g/mol. Its IUPAC name is 2-methoxyethyl 2,5-difluoro-3-nitrobenzoate.
| Compound Name | 2-methoxyethyl 2,5-difluoro-3-nitrobenzoate |
|---|---|
| PubChem CID | 107123604 |
| Molecular Formula | C10H9F2NO5 |
| Molecular Weight | 261.18 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | 2-methoxyethyl 2,5-difluoro-3-nitrobenzoate |
| SMILES | COCCOC(=O)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C10H9F2NO5/c1-17-2-3-18-10(14)7-4-6(11)5-8(9(7)12)13(15)16/h4-5H,2-3H2,1H3 |
| InChIKey | YNLIROJEOKPVIU-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 78.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.18 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|