C12H14F2N2O5 — CID 107121985
2,5-difluoro-N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-nitrobenzamide (PubChem CID 107121985) has the molecular formula C12H14F2N2O5 and a molecular weight of 304.25 g/mol. Its IUPAC name is 2,5-difluoro-N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-nitrobenzamide.
| Compound Name | 2,5-difluoro-N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 107121985 |
| Molecular Formula | C12H14F2N2O5 |
| Molecular Weight | 304.25 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | 2,5-difluoro-N-(2-hydroxy-3-methoxypropyl)-N-methyl-3-nitrobenzamide |
| SMILES | COCC(O)CN(C)C(=O)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C12H14F2N2O5/c1-15(5-8(17)6-21-2)12(18)9-3-7(13)4-10(11(9)14)16(19)20/h3-4,8,17H,5-6H2,1-2H3 |
| InChIKey | HRSDTDRNONZLTL-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 92.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.25 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|