C13H14F2N2O4 — CID 107122408
2,5-difluoro-N-(2-methoxyethyl)-3-nitro-N-prop-2-enylbenzamide (PubChem CID 107122408) has the molecular formula C13H14F2N2O4 and a molecular weight of 300.26 g/mol. Its IUPAC name is 2,5-difluoro-N-(2-methoxyethyl)-3-nitro-N-prop-2-enylbenzamide.
| Compound Name | 2,5-difluoro-N-(2-methoxyethyl)-3-nitro-N-prop-2-enylbenzamide |
|---|---|
| PubChem CID | 107122408 |
| Molecular Formula | C13H14F2N2O4 |
| Molecular Weight | 300.26 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2,5-difluoro-N-(2-methoxyethyl)-3-nitro-N-prop-2-enylbenzamide |
| SMILES | C=CCN(CCOC)C(=O)c1cc(F)cc([N+](=O)[O-])c1F |
| InChI | InChI=1S/C13H14F2N2O4/c1-3-4-16(5-6-21-2)13(18)10-7-9(14)8-11(12(10)15)17(19)20/h3,7-8H,1,4-6H2,2H3 |
| InChIKey | RNFJOBYMDPHJJR-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 72.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.26 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|