C24H14FeN4O8-6 — CID 11985029
9-(cyclopenta-2,4-dien-1-ylmethylidene)-2,4,5,7-tetranitrofluorene;cyclopentane;iron (PubChem CID 11985029) has the molecular formula C24H14FeN4O8-6 and a molecular weight of 542.24 g/mol. Its IUPAC name is 9-(cyclopenta-2,4-dien-1-ylmethylidene)-2,4,5,7-tetranitrofluorene;cyclopentane;iron.
| Compound Name | 9-(cyclopenta-2,4-dien-1-ylmethylidene)-2,4,5,7-tetranitrofluorene;cyclopentane;iron |
|---|---|
| PubChem CID | 11985029 |
| Molecular Formula | C24H14FeN4O8-6 |
| Molecular Weight | 542.24 g/mol |
| Exact Mass | 542.02 |
| IUPAC Name | 9-(cyclopenta-2,4-dien-1-ylmethylidene)-2,4,5,7-tetranitrofluorene;cyclopentane;iron |
| SMILES | O=[N+]([O-])c1cc2c(c([N+](=O)[O-])c1)-c1c(cc([N+](=O)[O-])cc1[N+](=O)[O-])C2=C[c-]1cccc1.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C19H9N4O8.C5H5.Fe/c24-20(25)11-6-14-13(5-10-3-1-2-4-10)15-7-12(21(26)27)9-17(23(30)31)19(15)18(14)16(8-11)22(28)29;1-2-4-5-3-1;/h1-9H;1-5H;/q-1;-5; |
| InChIKey | BWKNEBDFQIZOBN-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 172.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.24 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|