C24H16FeN2O4-6 — CID 11985031
9-(cyclopenta-2,4-dien-1-ylmethylidene)-2,7-dinitrofluorene;cyclopentane;iron (PubChem CID 11985031) has the molecular formula C24H16FeN2O4-6 and a molecular weight of 452.25 g/mol. Its IUPAC name is 9-(cyclopenta-2,4-dien-1-ylmethylidene)-2,7-dinitrofluorene;cyclopentane;iron.
| Compound Name | 9-(cyclopenta-2,4-dien-1-ylmethylidene)-2,7-dinitrofluorene;cyclopentane;iron |
|---|---|
| PubChem CID | 11985031 |
| Molecular Formula | C24H16FeN2O4-6 |
| Molecular Weight | 452.25 g/mol |
| Exact Mass | 452.05 |
| IUPAC Name | 9-(cyclopenta-2,4-dien-1-ylmethylidene)-2,7-dinitrofluorene;cyclopentane;iron |
| SMILES | O=[N+]([O-])c1ccc2c(c1)C(=C[c-]1cccc1)c1cc([N+](=O)[O-])ccc1-2.[Fe].[cH-]1[cH-][cH-][cH-][cH-]1 |
| InChI | InChI=1S/C19H11N2O4.C5H5.Fe/c22-20(23)13-5-7-15-16-8-6-14(21(24)25)11-19(16)17(18(15)10-13)9-12-3-1-2-4-12;1-2-4-5-3-1;/h1-11H;1-5H;/q-1;-5; |
| InChIKey | YUWFIVCZTCDKHQ-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.25 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|