C24H22N2O2 — CID 54431747
N,N-diethyl-4-[(2-nitrofluoren-9-ylidene)methyl]aniline (PubChem CID 54431747) has the molecular formula C24H22N2O2 and a molecular weight of 370.45 g/mol. Its IUPAC name is N,N-diethyl-4-[(2-nitrofluoren-9-ylidene)methyl]aniline.
| Compound Name | N,N-diethyl-4-[(2-nitrofluoren-9-ylidene)methyl]aniline |
|---|---|
| PubChem CID | 54431747 |
| Molecular Formula | C24H22N2O2 |
| Molecular Weight | 370.45 g/mol |
| Exact Mass | 370.17 |
| IUPAC Name | N,N-diethyl-4-[(2-nitrofluoren-9-ylidene)methyl]aniline |
| SMILES | CCN(CC)c1ccc(C=C2c3ccccc3-c3ccc([N+](=O)[O-])cc32)cc1 |
| InChI | InChI=1S/C24H22N2O2/c1-3-25(4-2)18-11-9-17(10-12-18)15-23-21-8-6-5-7-20(21)22-14-13-19(26(27)28)16-24(22)23/h5-16H,3-4H2,1-2H3 |
| InChIKey | WHYLOHPDZABACR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 46.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.45 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|