C13H10N4O8 — CID 88595157
2-methoxy-N-(2,4,6-trinitrophenoxy)aniline (PubChem CID 88595157) has the molecular formula C13H10N4O8 and a molecular weight of 350.24 g/mol. Its IUPAC name is 2-methoxy-N-(2,4,6-trinitrophenoxy)aniline.
| Compound Name | 2-methoxy-N-(2,4,6-trinitrophenoxy)aniline |
|---|---|
| PubChem CID | 88595157 |
| Molecular Formula | C13H10N4O8 |
| Molecular Weight | 350.24 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | 2-methoxy-N-(2,4,6-trinitrophenoxy)aniline |
| SMILES | COc1ccccc1NOc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H10N4O8/c1-24-12-5-3-2-4-9(12)14-25-13-10(16(20)21)6-8(15(18)19)7-11(13)17(22)23/h2-7,14H,1H3 |
| InChIKey | AXIZOXOWYSTECZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 159.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.24 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|