C13H13N5O7 — CID 132764843
3,5-dimethylpyridin-1-ium-4-amine;2,4,6-trinitrophenolate (PubChem CID 132764843) has the molecular formula C13H13N5O7 and a molecular weight of 351.28 g/mol. Its IUPAC name is 3,5-dimethylpyridin-1-ium-4-amine;2,4,6-trinitrophenolate.
| Compound Name | 3,5-dimethylpyridin-1-ium-4-amine;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 132764843 |
| Molecular Formula | C13H13N5O7 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 3,5-dimethylpyridin-1-ium-4-amine;2,4,6-trinitrophenolate |
| SMILES | Cc1c[nH+]cc(C)c1N.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C7H10N2.C6H3N3O7/c1-5-3-9-4-6(2)7(5)8;10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16/h3-4H,1-2H3,(H2,8,9);1-2,10H |
| InChIKey | DWKAKWCTNADKPM-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 192.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|