C10H9N5O8 — CID 139066202
1H-imidazol-3-ium-5-ylmethanol;2,4,6-trinitrophenolate (PubChem CID 139066202) has the molecular formula C10H9N5O8 and a molecular weight of 327.21 g/mol. Its IUPAC name is 1H-imidazol-3-ium-5-ylmethanol;2,4,6-trinitrophenolate.
| Compound Name | 1H-imidazol-3-ium-5-ylmethanol;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 139066202 |
| Molecular Formula | C10H9N5O8 |
| Molecular Weight | 327.21 g/mol |
| Exact Mass | 327.05 |
| IUPAC Name | 1H-imidazol-3-ium-5-ylmethanol;2,4,6-trinitrophenolate |
| SMILES | O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.OCc1c[nH+]c[nH]1 |
| InChI | InChI=1S/C6H3N3O7.C4H6N2O/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;7-2-4-1-5-3-6-4/h1-2,10H;1,3,7H,2H2,(H,5,6) |
| InChIKey | ZSHKBAUJMQICOD-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 202.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.21 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|