C12H15N5O8 — CID 139061033
piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate (PubChem CID 139061033) has the molecular formula C12H15N5O8 and a molecular weight of 357.28 g/mol. Its IUPAC name is piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate.
| Compound Name | piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 139061033 |
| Molecular Formula | C12H15N5O8 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate |
| SMILES | NC(=O)C1CC[NH2+]CC1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C6H12N2O/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;7-6(9)5-1-3-8-4-2-5/h1-2,10H;5,8H,1-4H2,(H2,7,9) |
| InChIKey | HTSQQSYBDTYEGI-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 212.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|