About piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate
piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate (PubChem CID 139061033) has the molecular formula C12H15N5O8
and a molecular weight of 357.28 g/mol. Its IUPAC name is piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate.
Molecular Properties
| Compound Name | piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate |
| PubChem CID | 139061033 |
| Molecular Formula | C12H15N5O8 |
| Molecular Weight | 357.28 g/mol |
| Exact Mass | 357.09 |
| IUPAC Name | piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate |
| SMILES | NC(=O)C1CC[NH2+]CC1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.C6H12N2O/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;7-6(9)5-1-3-8-4-2-5/h1-2,10H;5,8H,1-4H2,(H2,7,9) |
| InChIKey | HTSQQSYBDTYEGI-UHFFFAOYSA-N |
| XLogP | -1.07 |
| TPSA | 212.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.28 |
| LogP ≤ 5 | -1.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate?
The IUPAC name of piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate (CID 139061033) is piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate.
What is the SMILES notation for piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate?
The canonical SMILES for piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate is NC(=O)C1CC[NH2+]CC1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1.
What is the InChIKey of piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate?
The InChIKey is HTSQQSYBDTYEGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H3N3O7.C6H12N2O/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;7-6(9)5-1-3-8-4-2-5/h1-2,10H;5,8H,1-4H2,(H2,7,9).
What are the key properties of piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate?
piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate has a molecular weight of 357.28 g/mol, XLogP of -1.07, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for piperidin-1-ium-4-carboxamide;2,4,6-trinitrophenolate is sourced from PubChem (CID 139061033), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).