C18H17N5O9 — CID 139144317
4-methylpyridin-1-ium-2-ol;4-methyl-1H-pyridin-2-one;2,4,6-trinitrophenolate (PubChem CID 139144317) has the molecular formula C18H17N5O9 and a molecular weight of 447.36 g/mol. Its IUPAC name is 4-methylpyridin-1-ium-2-ol;4-methyl-1H-pyridin-2-one;2,4,6-trinitrophenolate.
| Compound Name | 4-methylpyridin-1-ium-2-ol;4-methyl-1H-pyridin-2-one;2,4,6-trinitrophenolate |
|---|---|
| PubChem CID | 139144317 |
| Molecular Formula | C18H17N5O9 |
| Molecular Weight | 447.36 g/mol |
| Exact Mass | 447.10 |
| IUPAC Name | 4-methylpyridin-1-ium-2-ol;4-methyl-1H-pyridin-2-one;2,4,6-trinitrophenolate |
| SMILES | Cc1cc[nH+]c(O)c1.Cc1cc[nH]c(=O)c1.O=[N+]([O-])c1cc([N+](=O)[O-])c([O-])c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C6H3N3O7.2C6H7NO/c10-6-4(8(13)14)1-3(7(11)12)2-5(6)9(15)16;2*1-5-2-3-7-6(8)4-5/h1-2,10H;2*2-4H,1H3,(H,7,8) |
| InChIKey | ZCMHUWZWLLGQGL-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 219.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.36 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|