About 7-methyl-1,3-dinitrodibenzo-p-dioxin
7-methyl-1,3-dinitrodibenzo-p-dioxin (PubChem CID 134912899) has the molecular formula C13H8N2O6
and a molecular weight of 288.22 g/mol. Its IUPAC name is 7-methyl-1,3-dinitrodibenzo-p-dioxin.
Molecular Properties
| Compound Name | 7-methyl-1,3-dinitrodibenzo-p-dioxin |
| PubChem CID | 134912899 |
| Molecular Formula | C13H8N2O6 |
| Molecular Weight | 288.22 g/mol |
| Exact Mass | 288.04 |
| IUPAC Name | 7-methyl-1,3-dinitrodibenzo-p-dioxin |
| SMILES | Cc1ccc2c(c1)Oc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O2 |
| InChI | InChI=1S/C13H8N2O6/c1-7-2-3-10-11(4-7)20-12-6-8(14(16)17)5-9(15(18)19)13(12)21-10/h2-6H,1H3 |
| InChIKey | VTXKWJQAIOAGNW-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.22 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 7-methyl-1,3-dinitrodibenzo-p-dioxin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methyl-1,3-dinitrodibenzo-p-dioxin?
The IUPAC name of 7-methyl-1,3-dinitrodibenzo-p-dioxin (CID 134912899) is 7-methyl-1,3-dinitrodibenzo-p-dioxin.
What is the SMILES notation for 7-methyl-1,3-dinitrodibenzo-p-dioxin?
The canonical SMILES for 7-methyl-1,3-dinitrodibenzo-p-dioxin is Cc1ccc2c(c1)Oc1cc([N+](=O)[O-])cc([N+](=O)[O-])c1O2.
What is the InChIKey of 7-methyl-1,3-dinitrodibenzo-p-dioxin?
The InChIKey is VTXKWJQAIOAGNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H8N2O6/c1-7-2-3-10-11(4-7)20-12-6-8(14(16)17)5-9(15(18)19)13(12)21-10/h2-6H,1H3.
What are the key properties of 7-methyl-1,3-dinitrodibenzo-p-dioxin?
7-methyl-1,3-dinitrodibenzo-p-dioxin has a molecular weight of 288.22 g/mol, XLogP of 3.71, 2 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methyl-1,3-dinitrodibenzo-p-dioxin is sourced from PubChem (CID 134912899), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).