C10H8F2N2O6 — CID 71651254
3,3-difluoro-2,2-dimethyl-5,7-dinitro-1,4-benzodioxine (PubChem CID 71651254) has the molecular formula C10H8F2N2O6 and a molecular weight of 290.18 g/mol. Its IUPAC name is 3,3-difluoro-2,2-dimethyl-5,7-dinitro-1,4-benzodioxine.
| Compound Name | 3,3-difluoro-2,2-dimethyl-5,7-dinitro-1,4-benzodioxine |
|---|---|
| PubChem CID | 71651254 |
| Molecular Formula | C10H8F2N2O6 |
| Molecular Weight | 290.18 g/mol |
| Exact Mass | 290.04 |
| IUPAC Name | 3,3-difluoro-2,2-dimethyl-5,7-dinitro-1,4-benzodioxine |
| SMILES | CC1(C)Oc2cc([N+](=O)[O-])cc([N+](=O)[O-])c2OC1(F)F |
| InChI | InChI=1S/C10H8F2N2O6/c1-9(2)10(11,12)20-8-6(14(17)18)3-5(13(15)16)4-7(8)19-9/h3-4H,1-2H3 |
| InChIKey | PZPLPCRWIXRRIB-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.18 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|