C8H3F2NO6 — CID 68502398
2,2-difluoro-6-nitro-1,3-benzodioxole-4-carboxylic acid (PubChem CID 68502398) has the molecular formula C8H3F2NO6 and a molecular weight of 247.11 g/mol. Its IUPAC name is 2,2-difluoro-6-nitro-1,3-benzodioxole-4-carboxylic acid.
| Compound Name | 2,2-difluoro-6-nitro-1,3-benzodioxole-4-carboxylic acid |
|---|---|
| PubChem CID | 68502398 |
| Molecular Formula | C8H3F2NO6 |
| Molecular Weight | 247.11 g/mol |
| Exact Mass | 246.99 |
| IUPAC Name | 2,2-difluoro-6-nitro-1,3-benzodioxole-4-carboxylic acid |
| SMILES | O=C(O)c1cc([N+](=O)[O-])cc2c1OC(F)(F)O2 |
| InChI | InChI=1S/C8H3F2NO6/c9-8(10)16-5-2-3(11(14)15)1-4(7(12)13)6(5)17-8/h1-2H,(H,12,13) |
| InChIKey | IXELOWFFPMBFFH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 98.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.11 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|