C25H30N2O8 — CID 158827062
4-[(1-methylcyclopropyl)methyl]-2-nitrophenol;methyl 2-[4-[(1-methylcyclopropyl)methyl]-2-nitrophenoxy]acetate (PubChem CID 158827062) has the molecular formula C25H30N2O8 and a molecular weight of 486.52 g/mol. Its IUPAC name is 4-[(1-methylcyclopropyl)methyl]-2-nitrophenol;methyl 2-[4-[(1-methylcyclopropyl)methyl]-2-nitrophenoxy]acetate.
| Compound Name | 4-[(1-methylcyclopropyl)methyl]-2-nitrophenol;methyl 2-[4-[(1-methylcyclopropyl)methyl]-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 158827062 |
| Molecular Formula | C25H30N2O8 |
| Molecular Weight | 486.52 g/mol |
| Exact Mass | 486.20 |
| IUPAC Name | 4-[(1-methylcyclopropyl)methyl]-2-nitrophenol;methyl 2-[4-[(1-methylcyclopropyl)methyl]-2-nitrophenoxy]acetate |
| SMILES | CC1(Cc2ccc(O)c([N+](=O)[O-])c2)CC1.COC(=O)COc1ccc(CC2(C)CC2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H17NO5.C11H13NO3/c1-14(5-6-14)8-10-3-4-12(11(7-10)15(17)18)20-9-13(16)19-2;1-11(4-5-11)7-8-2-3-10(13)9(6-8)12(14)15/h3-4,7H,5-6,8-9H2,1-2H3;2-3,6,13H,4-5,7H2,1H3 |
| InChIKey | IWOWYKYATKZXIP-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 142.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.52 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|