C15H21N3O6 — CID 120844406
methyl 2-[4-[[2-(aminomethyl)morpholin-4-yl]methyl]-2-nitrophenoxy]acetate (PubChem CID 120844406) has the molecular formula C15H21N3O6 and a molecular weight of 339.35 g/mol. Its IUPAC name is methyl 2-[4-[[2-(aminomethyl)morpholin-4-yl]methyl]-2-nitrophenoxy]acetate.
| Compound Name | methyl 2-[4-[[2-(aminomethyl)morpholin-4-yl]methyl]-2-nitrophenoxy]acetate |
|---|---|
| PubChem CID | 120844406 |
| Molecular Formula | C15H21N3O6 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.14 |
| IUPAC Name | methyl 2-[4-[[2-(aminomethyl)morpholin-4-yl]methyl]-2-nitrophenoxy]acetate |
| SMILES | COC(=O)COc1ccc(CN2CCOC(CN)C2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H21N3O6/c1-22-15(19)10-24-14-3-2-11(6-13(14)18(20)21)8-17-4-5-23-12(7-16)9-17/h2-3,6,12H,4-5,7-10,16H2,1H3 |
| InChIKey | SNCBWXZGQMALTR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 117.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|